/* * Cantata * * Copyright (c) 2011-2018 Craig Drummond * * ---- * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or * (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU * General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program; see the file COPYING. If not, write to * the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, * Boston, MA 02110-1301, USA. */ #include "dialog.h" #include "configuration.h" #include "utils.h" #include "monoicon.h" #ifdef Q_OS_MAC #include "osxstyle.h" #endif #include "icon.h" #include "acceleratormanager.h" #include #include #include #include #include Dialog::Dialog(QWidget *parent, const QString &name, const QSize &defSize) : QDialog(parent) , defButton(0) , buttonTypes(0) , mw(nullptr) , buttonBox(nullptr) , shown(false) { if (!name.isEmpty()) { setObjectName(name); Configuration cfg(name); cfgSize=cfg.get("size", QSize()); if (!cfgSize.isEmpty()) { QDialog::resize(cfgSize); } else if (!defSize.isEmpty()) { QDialog::resize(defSize); } } #ifdef Q_OS_MAC setWindowIcon(QIcon()); #endif } Dialog::~Dialog() { if (!objectName().isEmpty() && size()!=cfgSize) { Configuration cfg(objectName()); cfg.set("size", size()); } #ifdef Q_OS_MAC OSXStyle::self()->removeWindow(this); #endif } void Dialog::resize(const QSize &sz) { if (cfgSize.isEmpty()) { QDialog::resize(sz); cfgSize=sz; } } #ifdef Q_OS_MAC Dialog::ButtonProxyStyle::ButtonProxyStyle() : QProxyStyle() { setBaseStyle(qApp->style()); } int Dialog::ButtonProxyStyle::styleHint(StyleHint stylehint, const QStyleOption *opt, const QWidget *widget, QStyleHintReturn *returnData) const { if (QStyle::SH_DialogButtonLayout==stylehint) { return QDialogButtonBox::GnomeLayout; } else { return QProxyStyle::styleHint(stylehint, opt, widget, returnData); } } Dialog::ButtonProxyStyle * Dialog::buttonProxyStyle() { static ButtonProxyStyle *style=0; if (!style) { style=new ButtonProxyStyle(); } return style; } #endif static QIcon monoIcon(const GuiItem &i) { static QColor col(QColor::Invalid); if (!i.red && !col.isValid()) { col=Utils::monoIconColor(); } return MonoIcon::icon((FontAwesome::icon)i.monoIcon, i.red ? MonoIcon::constRed : col, i.red ? MonoIcon::constRed : QColor(QColor::Invalid)); } namespace StdGuiItem { GuiItem ok() { return GuiItem(QObject::tr("&OK"), FontAwesome::check); } GuiItem cancel() { return GuiItem(QObject::tr("&Cancel"), FontAwesome::ban, true); } GuiItem yes() { return GuiItem(QObject::tr("&Yes"), FontAwesome::check); } GuiItem no() { return GuiItem(QObject::tr("&No"), FontAwesome::times, true); } GuiItem discard() { return GuiItem(QObject::tr("&Discard"), FontAwesome::eraser, true); } GuiItem save() { return GuiItem(QObject::tr("&Save"), FontAwesome::save); } GuiItem apply() { return GuiItem(QObject::tr("&Apply"), FontAwesome::check); } GuiItem close() { return GuiItem(QObject::tr("&Close"), FontAwesome::close, true); } GuiItem help() { return GuiItem(QObject::tr("&Help"), FontAwesome::lifering); } GuiItem overwrite() { return GuiItem(QObject::tr("&Overwrite")); } GuiItem reset() { return GuiItem(QObject::tr("&Reset"), FontAwesome::undo); } GuiItem cont() { return GuiItem(QObject::tr("&Continue"), FontAwesome::arrowright); } GuiItem del() { return GuiItem(QObject::tr("&Delete"), FontAwesome::trash, true); } GuiItem stop() { return GuiItem(QObject::tr("&Stop"), FontAwesome::times); } GuiItem remove() { return GuiItem(QObject::tr("&Remove"), FontAwesome::remove); } GuiItem back(bool useRtl) { return GuiItem(QObject::tr("&Previous"), useRtl && QApplication::isRightToLeft() ? FontAwesome::chevronright : FontAwesome::chevronleft); } GuiItem forward(bool useRtl) { return GuiItem(QObject::tr("&Next"), useRtl && QApplication::isRightToLeft() ? FontAwesome::chevronleft : FontAwesome::chevronright); } QSet standardNames() { static QSet names; if (names.isEmpty()) { QStringList strings = QStringList() << ok().text << cancel().text << yes().text << no().text << discard().text << save().text << apply().text << close().text << help().text << overwrite().text << reset().text << cont().text << del().text << stop().text << remove().text << back().text << forward().text; for (QString s: strings) { names.insert(s.remove("&")); } } return names; } } static QDialogButtonBox::StandardButton mapType(int btn) { switch (btn) { case Dialog::Help: return QDialogButtonBox::Help; case Dialog::Ok: return QDialogButtonBox::Ok; case Dialog::Apply: return QDialogButtonBox::Apply; case Dialog::Cancel: return QDialogButtonBox::Cancel; case Dialog::Close: return QDialogButtonBox::Close; case Dialog::No: return QDialogButtonBox::No; case Dialog::Yes: return QDialogButtonBox::Yes; case Dialog::Reset: return QDialogButtonBox::Reset; default: return QDialogButtonBox::NoButton; } } void Dialog::setButtons(ButtonCodes buttons) { if (buttonBox && buttons==buttonTypes) { return; } QFlags btns; if (buttons&Help) { btns|=QDialogButtonBox::Help; } if (buttons&Ok) { btns|=QDialogButtonBox::Ok; } if (buttons&Apply) { btns|=QDialogButtonBox::Apply; } if (buttons&Cancel) { btns|=QDialogButtonBox::Cancel; } if (buttons&Close) { btns|=QDialogButtonBox::Close; } if (buttons&No) { btns|=QDialogButtonBox::No; } if (buttons&Yes) { btns|=QDialogButtonBox::Yes; } if (buttons&Reset) { btns|=QDialogButtonBox::Reset; } buttonTypes=(int)btns; bool needToCreate=true; if (buttonBox) { needToCreate=false; buttonBox->clear(); buttonBox->setStandardButtons(btns); userButtons.clear(); } else { buttonBox = new QDialogButtonBox(btns, Qt::Horizontal, this); #ifdef Q_OS_MAC buttonBox->setStyle(buttonProxyStyle()); #endif } if (buttons&Help) { setButtonGuiItem(QDialogButtonBox::Help, StdGuiItem::help()); } if (buttons&Ok) { setButtonGuiItem(QDialogButtonBox::Ok, StdGuiItem::ok()); } if (buttons&Apply) { setButtonGuiItem(QDialogButtonBox::Apply, StdGuiItem::apply()); } if (buttons&Cancel) { setButtonGuiItem(QDialogButtonBox::Cancel, StdGuiItem::cancel()); } if (buttons&Close) { setButtonGuiItem(QDialogButtonBox::Close, StdGuiItem::close()); } if (buttons&No) { setButtonGuiItem(QDialogButtonBox::No, StdGuiItem::no()); } if (buttons&Yes) { setButtonGuiItem(QDialogButtonBox::Yes, StdGuiItem::yes()); } if (buttons&Reset) { setButtonGuiItem(QDialogButtonBox::Reset, StdGuiItem::reset()); } if (buttons&User3) { QPushButton *button=new QPushButton(buttonBox); userButtons.insert(User3, button); buttonBox->addButton(button, QDialogButtonBox::ActionRole); } if (buttons&User2) { QPushButton *button=new QPushButton(buttonBox); userButtons.insert(User2, button); buttonBox->addButton(button, QDialogButtonBox::ActionRole); } if (buttons&User1) { QPushButton *button=new QPushButton(buttonBox); userButtons.insert(User1, button); buttonBox->addButton(button, QDialogButtonBox::ActionRole); } if (needToCreate && mw && buttonBox) { create(); } } void Dialog::setDefaultButton(ButtonCode button) { QAbstractButton *b=getButton(button); if (b) { qobject_cast(b)->setDefault(true); } defButton=button; } void Dialog::setButtonText(ButtonCode button, const QString &text) { QAbstractButton *b=getButton(button); if (b) { b->setText(text); } } void Dialog::setButtonGuiItem(ButtonCode button, const GuiItem &item) { QAbstractButton *b=getButton(button); if (b) { b->setText(item.text); if (style()->styleHint(QStyle::SH_DialogButtonBox_ButtonsHaveIcons)) { if (!item.icon.isEmpty()) { b->setIcon(Icon::get(item.icon)); } else if (item.monoIcon>0) { b->setIcon(monoIcon(item)); } else { b->setIcon(QIcon()); } } } } void Dialog::setButtonGuiItem(QDialogButtonBox::StandardButton button, const GuiItem &item) { QAbstractButton *b=buttonBox->button(button); if (b) { b->setText(item.text); if (style()->styleHint(QStyle::SH_DialogButtonBox_ButtonsHaveIcons)) { if (!item.icon.isEmpty()) { b->setIcon(Icon::get(item.icon)); } else if (item.monoIcon>0) { b->setIcon(monoIcon(item)); } else { b->setIcon(QIcon()); } } } } void Dialog::setButtonMenu(ButtonCode button, QMenu *menu, ButtonPopupMode popupmode) { Q_UNUSED(popupmode) QAbstractButton *b=getButton(button); if (b) { qobject_cast(b)->setMenu(menu); } } void Dialog::enableButton(ButtonCode button, bool enable) { QAbstractButton *b=getButton(button); if (b) { b->setEnabled(enable); } } bool Dialog::isButtonEnabled(ButtonCode button) { QAbstractButton *b=getButton(button); return b ? b->isEnabled() : false; } void Dialog::setMainWidget(QWidget *widget) { if (mw) { return; } mw=widget; if (mw && buttonBox) { create(); } } void Dialog::slotButtonClicked(int button) { switch (button) { case Ok: accept(); break; case Cancel: reject(); break; case Close: reject(); break; default: break; } } void Dialog::buttonPressed(QAbstractButton *button) { if (buttonTypes&QDialogButtonBox::Help && button==buttonBox->button(QDialogButtonBox::Help)) { slotButtonClicked(Help); } else if (buttonTypes&QDialogButtonBox::Ok && button==buttonBox->button(QDialogButtonBox::Ok)) { slotButtonClicked(Ok); } else if (buttonTypes&QDialogButtonBox::Apply && button==buttonBox->button(QDialogButtonBox::Apply)) { slotButtonClicked(Apply); } else if (buttonTypes&QDialogButtonBox::Cancel && button==buttonBox->button(QDialogButtonBox::Cancel)) { slotButtonClicked(Cancel); } else if (buttonTypes&QDialogButtonBox::Close && button==buttonBox->button(QDialogButtonBox::Close)) { slotButtonClicked(Close); } else if (buttonTypes&QDialogButtonBox::No && button==buttonBox->button(QDialogButtonBox::No)) { slotButtonClicked(No); } else if (buttonTypes&QDialogButtonBox::Yes && button==buttonBox->button(QDialogButtonBox::Yes)) { slotButtonClicked(Yes); } else if (buttonTypes&QDialogButtonBox::Reset && button==buttonBox->button(QDialogButtonBox::Reset)) { slotButtonClicked(Reset); } else if (userButtons.contains(User1) && userButtons[User1]==button) { slotButtonClicked(User1); } else if (userButtons.contains(User2) && userButtons[User2]==button) { slotButtonClicked(User2); } else if (userButtons.contains(User3) && userButtons[User3]==button) { slotButtonClicked(User3); } } void Dialog::create() { QBoxLayout *layout=new QBoxLayout(QBoxLayout::TopToBottom, this); layout->addWidget(mw); layout->addWidget(buttonBox); connect(buttonBox, SIGNAL(clicked(QAbstractButton *)), this, SLOT(buttonPressed(QAbstractButton *))); } QAbstractButton *Dialog::getButton(ButtonCode button) { QDialogButtonBox::StandardButton mapped=mapType(button); QAbstractButton *b=QDialogButtonBox::NoButton==mapped ? nullptr : buttonBox->button(mapped); if (!b && userButtons.contains(button)) { b=userButtons[button]; } return b; } void Dialog::showEvent(QShowEvent *e) { if (!shown) { shown=true; AcceleratorManager::manage(this); if (defButton) { setDefaultButton((ButtonCode)defButton); } if (buttonBox && mw) { QSize mwSize=mw->minimumSize(); if (mwSize.width()<16 || mwSize.height()<16) { mwSize=mw->minimumSizeHint(); } if (mwSize.width()>15 && mwSize.height()>15) { setMinimumHeight(qMax(minimumHeight(), buttonBox->height()+layout()->spacing()+mwSize.height()+(2*layout()->margin()))); setMinimumWidth(qMax(minimumWidth(), mwSize.width()+(2*layout()->margin()))); } } } #ifdef Q_OS_MAC if (!isModal()) { OSXStyle::self()->addWindow(this); } #endif QDialog::showEvent(e); } #ifdef Q_OS_MAC void Dialog::hideEvent(QHideEvent *e) { OSXStyle::self()->removeWindow(this); QDialog::hideEvent(e); } void Dialog::closeEvent(QCloseEvent *e) { OSXStyle::self()->removeWindow(this); QDialog::closeEvent(e); } #endif #include "moc_dialog.cpp"